80407-53-0 Usage
Description
1,2-dihydro-1-(m-hydroxyphenyl)-5H-tetrazole-5-thione is a chemical compound with the molecular formula C8H8N4OS. It is a tetrazole derivative featuring a thione functional group and a hydroxyphenyl substituent. 1,2-dihydro-1-(m-hydroxyphenyl)-5H-tetrazole-5-thione holds potential in medicinal chemistry due to the diverse biological activities associated with tetrazole derivatives, such as antimicrobial, antiviral, and antitumor properties. The presence of the thione moiety may further enhance its biological and pharmacological activities, although more research is required to explore its full potential.
Uses
Used in Medicinal Chemistry:
1,2-dihydro-1-(m-hydroxyphenyl)-5H-tetrazole-5-thione is used as a compound with potential applications in medicinal chemistry for its diverse biological activities. The tetrazole derivatives, to which it belongs, have been found to exhibit antimicrobial, antiviral, and antitumor properties, making it a promising candidate for the development of new therapeutic agents.
Used in Antimicrobial Agents:
In the field of antimicrobial agents, 1,2-dihydro-1-(m-hydroxyphenyl)-5H-tetrazole-5-thione is used to target and combat various types of bacteria and other microorganisms. Its tetrazole structure is known to contribute to its effectiveness in this application.
Used in Antiviral Agents:
1,2-dihydro-1-(m-hydroxyphenyl)-5H-tetrazole-5-thione is also used as an antiviral agent, leveraging its tetrazole properties to inhibit viral replication and reduce the spread of viral infections.
Used in Antitumor Agents:
In the realm of antitumor agents, 1,2-dihydro-1-(m-hydroxyphenyl)-5H-tetrazole-5-thione is used for its potential to combat tumor growth. Its tetrazole and thione components may contribute to its effectiveness in inhibiting cancer cell proliferation and promoting apoptosis.
Further research is necessary to fully understand the potential uses and effects of 1,2-dihydro-1-(m-hydroxyphenyl)-5H-tetrazole-5-thione, as well as to optimize its synthesis and application in various fields of medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 80407-53-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,4,0 and 7 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80407-53:
(7*8)+(6*0)+(5*4)+(4*0)+(3*7)+(2*5)+(1*3)=110
110 % 10 = 0
So 80407-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H6N4OS/c12-6-3-1-2-5(4-6)11-7(13)8-9-10-11/h1-4,12H,(H,8,10,13)