80440-95-5 Usage
Description
2-Furoyl isothiocyanate, also known as 2-FITC, is a chemical compound with the formula C6H3O2NCS. It is a yellowish liquid that is highly reactive and can easily form covalent bonds with proteins and amino acids. Its unique chemical structure and reactivity make it a valuable tool in drug development and chemical research. 2-FITC is known for its potent anti-cancer and anti-microbial properties and is often used in research to explore its potential as a therapeutic agent.
Uses
Used in Pharmaceutical Industry:
2-Furoyl isothiocyanate is used as a therapeutic agent for its potent anti-cancer properties. It modulates several oncological signaling pathways, exerting inhibitory effects on tumor growth and progression. Its reactivity allows it to form covalent bonds with proteins and amino acids, making it a promising candidate for the development of targeted cancer therapies.
Used in Organic Synthesis:
2-Furoyl isothiocyanate is used as a reactive intermediate in organic synthesis. Its ability to form covalent bonds with various molecules makes it a versatile building block for the synthesis of complex organic compounds.
Used in Medicinal Chemistry:
2-Furoyl isothiocyanate is used in medicinal chemistry for the development of new drugs and therapeutic agents. Its unique chemical structure and reactivity enable the design and synthesis of novel compounds with potential applications in various therapeutic areas.
Used in Research:
2-Furoyl isothiocyanate is used in research to explore its potential as a therapeutic agent. Its potent anti-cancer and anti-microbial properties make it an interesting subject for scientific investigation, with the aim of understanding its mechanisms of action and identifying new applications in medicine.
Used in Drug Development:
2-Furoyl isothiocyanate is used in drug development to create new pharmaceutical compounds. Its reactivity and unique chemical structure make it a valuable tool for the design and synthesis of innovative drugs with improved efficacy and selectivity.
Used in Chemical Research:
2-Furoyl isothiocyanate is used in chemical research to study its reactivity and explore its potential applications in various chemical processes. Its ability to form covalent bonds with proteins and amino acids makes it an interesting subject for understanding the fundamental principles of chemical reactions and interactions.
Check Digit Verification of cas no
The CAS Registry Mumber 80440-95-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,4,4 and 0 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 80440-95:
(7*8)+(6*0)+(5*4)+(4*4)+(3*0)+(2*9)+(1*5)=115
115 % 10 = 5
So 80440-95-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H3NO2S/c8-6(7-4-10)5-2-1-3-9-5/h1-3H