80459-00-3 Usage
Uses
Used in Scientific Research:
Ethanone, 2,2-difluoro-1-(2-pyridinyl)(9CI) is used as a research compound for its unique structure and potential applications in various scientific studies. Its distinct integration of carbon, hydrogen, nitrogen, and fluorine atoms makes it a valuable compound for synthesis in research laboratories.
Used in Chemical Synthesis:
Ethanone, 2,2-difluoro-1-(2-pyridinyl)(9CI) is used as a key intermediate in the synthesis of other complex molecules, contributing to the development of new chemical entities and compounds. Its unique structure and reactivity make it a promising candidate for further exploration in chemical synthesis processes.
Used in Safety and Handling Protocols:
Ethanone, 2,2-difluoro-1-(2-pyridinyl)(9CI) is used as a reference compound in the development of safety and handling protocols for chemicals containing fluorine, a highly reactive element. Its presence in the compound necessitates the establishment of proper protective measures, adherence to safety rules, and controlled conditions to ensure the safety of researchers and the integrity of experimental procedures.
Check Digit Verification of cas no
The CAS Registry Mumber 80459-00-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,4,5 and 9 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 80459-00:
(7*8)+(6*0)+(5*4)+(4*5)+(3*9)+(2*0)+(1*0)=123
123 % 10 = 3
So 80459-00-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H5F2NO/c8-7(9)6(11)5-3-1-2-4-10-5/h1-4,7H
80459-00-3Relevant academic research and scientific papers
Secondary alcohol hemiacetal formation: An in situ carbonyl activation strategy
You, Lei,Anslyn, Eric V.
supporting information; experimental part, p. 5126 - 5129 (2009/12/28)
A simple strategy was studied for the reversible nucleophilic addition of secondary alcohols to carbonyl-based receptors to form hemiacetals. It involves the in situ binding of neighboring Bronsted and Lewis acids activators. The addition reaction was suc
