80546-88-9 Usage
Uses
Used in Pharmaceutical Industry:
3-Aminopyrrolidine-3-carboxylic acid is used as a building block for the synthesis of various pharmaceuticals and bioactive compounds. Its unique chemical structure and reactivity contribute to the development of new drugs with potential therapeutic applications.
Used in Cancer Treatment:
3-Aminopyrrolidine-3-carboxylic acid is used as a potential therapeutic agent in the treatment of cancer. It has been studied for its ability to target and inhibit the growth of cancer cells, making it a promising candidate for further research and development in oncology.
Used in Antiviral Applications:
3-Aminopyrrolidine-3-carboxylic acid is also used as a potential therapeutic agent in the treatment of viral infections. Its unique chemical properties may allow it to target and inhibit the replication of viruses, offering a new approach to antiviral therapy.
Check Digit Verification of cas no
The CAS Registry Mumber 80546-88-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,5,4 and 6 respectively; the second part has 2 digits, 8 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 80546-88:
(7*8)+(6*0)+(5*5)+(4*4)+(3*6)+(2*8)+(1*8)=139
139 % 10 = 9
So 80546-88-9 is a valid CAS Registry Number.
InChI:InChI=1/C5H10N2O2/c6-5(4(8)9)1-2-7-3-5/h7H,1-3,6H2,(H,8,9)
