805946-35-4 Usage
Description
5-[4-(Ethylamino)butyl]hydantoin, with the chemical abstracts service number 805946-35-4, is an organic compound that plays a significant role in various chemical processes and reactions. Its unique molecular structure, featuring a hydantoin core with an ethylaminobutyl side chain, endows it with specific reactivity and properties that make it valuable in the field of organic synthesis.
Uses
Used in Organic Synthesis:
5-[4-(Ethylamino)butyl]hydantoin is used as a synthetic intermediate for the development of various organic compounds. Its presence in reactions can lead to the formation of complex molecules with diverse applications across different industries. The ethylaminobutyl group attached to the hydantoin ring provides a versatile platform for further functionalization and modification, making it a key component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 5-[4-(Ethylamino)butyl]hydantoin is utilized as a building block for the synthesis of new drug candidates. Its unique structure can be incorporated into molecules that target specific biological pathways or receptors, potentially leading to the discovery of novel therapeutic agents. 5-[4-(Ethylamino)butyl]hydantoin's reactivity and functional groups allow for the creation of diverse drug-like molecules with improved pharmacological properties.
Used in Agrochemical Industry:
5-[4-(Ethylamino)butyl]hydantoin also finds application in the agrochemical sector, where it serves as a precursor for the synthesis of new pesticides, herbicides, and other crop protection agents. Its ability to be modified and functionalized allows for the development of compounds with enhanced efficacy, selectivity, and environmental compatibility.
Used in Specialty Chemicals:
In the realm of specialty chemicals, 5-[4-(Ethylamino)butyl]hydantoin is employed for the synthesis of compounds with specific applications, such as in the production of dyes, fragrances, and other high-value products. Its unique structural features enable the creation of molecules with tailored properties, catering to the needs of various specialized applications.
Check Digit Verification of cas no
The CAS Registry Mumber 805946-35-4 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,0,5,9,4 and 6 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 805946-35:
(8*8)+(7*0)+(6*5)+(5*9)+(4*4)+(3*6)+(2*3)+(1*5)=184
184 % 10 = 4
So 805946-35-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H17N3O2/c1-2-10-6-4-3-5-7-8(13)12-9(14)11-7/h7,10H,2-6H2,1H3,(H2,11,12,13,14)