80653-66-3 Usage
Uses
Used in Pharmaceutical Industry:
THIAZOLE-4-CARBOTHIOIC ACID AMIDE is used as a building block for the synthesis of various pharmaceutical compounds due to its unique chemical structure and reactivity. Its presence in the development of antitumor and antifungal drugs highlights its potential in creating novel therapeutic agents.
Used in Organic Synthesis:
THIAZOLE-4-CARBOTHIOIC ACID AMIDE is used as a versatile reagent in organic synthesis for the creation of a wide range of chemical products. Its ability to participate in various chemical reactions makes it a valuable component in the synthesis of complex organic molecules.
Used in Medicinal Chemistry Research:
THIAZOLE-4-CARBOTHIOIC ACID AMIDE is used as a subject of research in medicinal chemistry for exploring its potential in the development of new drugs. Its unique properties and reactivity offer opportunities for further investigation into its therapeutic applications and mechanisms of action.
Check Digit Verification of cas no
The CAS Registry Mumber 80653-66-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,6,5 and 3 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 80653-66:
(7*8)+(6*0)+(5*6)+(4*5)+(3*3)+(2*6)+(1*6)=133
133 % 10 = 3
So 80653-66-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H4N2S2/c5-4(7)3-1-6-2-8-3/h1-2H,(H2,5,7)
80653-66-3Relevant articles and documents
Potent and orally efficacious bisthiazole-based histone deacetylase inhibitors
Chen, Fei,Chai, Hui,Su, Ming-Bo,Zhang, Yang-Ming,Li, Jia,Xie, Xin,Nan, Fa-Jun
supporting information, p. 628 - 633 (2014/07/07)
Inspired by the thiazole-thiazoline cap group in natural product largazole, a series of structurally simplified bisthiazole-based histone deacetylase inhibitors were prepared and evaluated. Compound 8f was evaluated in vivo in an experimental autoimmune encephalomyelitis (EAE) model and found to be orally efficacious in ameliorating clinical symptoms of EAE mice.
