80653-76-5 Usage
General Description
Maleimide, 4-hydroxy-3-(2-(pyridyl)-4-thiazolyl)-, is a chemical compound consisting of a maleimide group and a hydroxy-thiazolyl-pyridyl moiety. Maleimide, 4-hydroxy-3-(2-(pyridyl)-4-thiazolyl)- is commonly used in chemical biology and bioconjugation applications due to its ability to form stable covalent bonds with thiol-containing biomolecules. The maleimide group reacts with thiol groups on proteins, peptides, or other biomolecules to form a stable thioether bond, making it a valuable tool for labeling and modifying biomolecules. Additionally, the 4-hydroxy-3-(2-(pyridyl)-4-thiazolyl)- part of the compound provides additional functional groups for further chemical modifications, making it a versatile building block for the synthesis of bioconjugates and drug delivery systems.
Check Digit Verification of cas no
The CAS Registry Mumber 80653-76-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,6,5 and 3 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 80653-76:
(7*8)+(6*0)+(5*6)+(4*5)+(3*3)+(2*7)+(1*6)=135
135 % 10 = 5
So 80653-76-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H7N3O3S/c16-9-8(10(17)15-11(9)18)7-5-19-12(14-7)6-1-3-13-4-2-6/h1-5H,(H2,15,16,17,18)
