80660-66-8 Usage
General Description
(o-Phenylenediamine)oxalatoiron is a chemical compound with the molecular formula Fe(C2O4)(C6H8N2). It is an organometallic complex of iron and oxalate ligands, with o-Phenylenediamine serving as the organic ligand. (o-Phenylenediamine)oxalatoiron has been studied for its potential application in catalysis and coordination chemistry due to its unique coordination environment and reactivity. It is also used in the synthesis of various coordination complexes and materials. Additionally, its magnetic properties have been of interest for potential application in spin crossover materials and molecular magnets. Overall, (o-Phenylenediamine)oxalatoiron is a versatile chemical compound with potential applications in various fields of chemistry and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 80660-66-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,6,6 and 0 respectively; the second part has 2 digits, 6 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 80660-66:
(7*8)+(6*0)+(5*6)+(4*6)+(3*0)+(2*6)+(1*6)=128
128 % 10 = 8
So 80660-66-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2.C2H2O4.Fe/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h1-4H,7-8H2;(H,3,4)(H,5,6);/q;;+2/p-2
