80672-97-5 Usage
Structure
The compound has a complex structure that includes a phenoxyacetic acid backbone with a 2,3-dichloro-4-[(E)-3-oxo-3-thiophen-2-yl-prop-1-enyl] group attached to the phenoxy ring.
Chlorine content
The compound contains two chlorine atoms, which are attached to the phenoxy ring and may have toxicological implications.
Thiophene content
The compound contains a 3-thiophen-2-yl group, which is an unsaturated side chain with sulfur atom that may also have toxicological implications.
Carboxylic acid functional group
The compound has a carboxylic acid functional group (-COOH) attached to the phenoxy ring, which is a common component of herbicides and plant growth regulators.
Derivative of phenoxyacetic acid
The compound is a derivative of phenoxyacetic acid, which is a widely used herbicide and plant growth regulator.
Agricultural and horticultural applications
The compound has potential applications in agriculture and horticulture due to its ability to regulate plant growth and control weeds.
Environmental persistence and bioaccumulation
The compound's potential for environmental persistence and bioaccumulation should be carefully considered due to its complex structure.
Need for further research
Further research is needed to fully understand the properties and potential impacts of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 80672-97-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,6,7 and 2 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 80672-97:
(7*8)+(6*0)+(5*6)+(4*7)+(3*2)+(2*9)+(1*7)=145
145 % 10 = 5
So 80672-97-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H10Cl2O4S/c16-14-9(3-5-10(18)12-2-1-7-22-12)4-6-11(15(14)17)21-8-13(19)20/h1-7H,8H2,(H,19,20)/b5-3+
