80712-08-9 Usage
Uses
1. Used in Pharmaceutical Applications:
1-(4-Methylallophanoyl)-4-(o-tolyl)piperazine is used as a potential therapeutic agent for various medical conditions due to its pharmacological properties. Its specific application reasons and the conditions it may target are yet to be determined through further research and testing.
2. Used in Medicinal Chemistry Research:
1-(4-Methylallophanoyl)-4-(o-tolyl)piperazine serves as a subject of study in medicinal chemistry, where it may contribute to the development of new drugs or the enhancement of existing ones. The exact reasons for its use in this field will depend on the outcomes of ongoing investigations into its properties and potential interactions with biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 80712-08-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,7,1 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 80712-08:
(7*8)+(6*0)+(5*7)+(4*1)+(3*2)+(2*0)+(1*8)=109
109 % 10 = 9
So 80712-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C14H20N4O2/c1-11-5-3-4-6-12(11)17-7-9-18(10-8-17)14(20)16-13(19)15-2/h3-6H,7-10H2,1-2H3,(H2,15,16,19,20)
