80712-13-6 Usage
Uses
Used in Pharmaceutical Research and Development:
1-(2,4-Dimethylallophanoyl)-4-(2-chlorophenyl)piperazine is used as a research compound for the development of pharmaceutical drugs due to its unique chemical structure and potential therapeutic properties.
Used in the Treatment of Medical Conditions:
1-(2,4-Dimethylallophanoyl)-4-(2-chlorophenyl)piperazine is used as a potential treatment option for various medical conditions, given its promising results in pharmaceutical research. However, more extensive research and clinical trials are required to confirm its efficacy and safety in treating specific conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 80712-13-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,7,1 and 2 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 80712-13:
(7*8)+(6*0)+(5*7)+(4*1)+(3*2)+(2*1)+(1*3)=106
106 % 10 = 6
So 80712-13-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H19ClN4O2/c1-16-13(20)17(2)14(21)19-9-7-18(8-10-19)12-6-4-3-5-11(12)15/h3-6H,7-10H2,1-2H3,(H,16,20)