80712-15-8 Usage
Uses
Used in Scientific Research:
1-(2,4-Dimethylallophanoyl)-4-(4-chlorophenyl)piperazine is used as a reference standard for analytical testing in the field of chemistry and pharmaceuticals. Its well-defined structure and properties make it a valuable tool for calibrating instruments and validating experimental methods.
Used in Pharmaceutical Development:
AAF4 is used as a starting material or intermediate in the development of new pharmaceuticals. Its unique chemical properties and potential therapeutic effects make it a promising candidate for the creation of novel drugs, particularly for neurological and psychiatric disorders.
Used in Treatment of Neurological and Psychiatric Disorders:
1-(2,4-Dimethylallophanoyl)-4-(4-chlorophenyl)piperazine is being studied for its potential therapeutic effects in the treatment of neurological and psychiatric disorders. Its precise mechanisms of action and therapeutic potential are still being explored, but initial research suggests that it may have beneficial effects on these conditions.
Used in Industrial Applications:
AAF4 has potential industrial applications, particularly in the development of new materials and in chemical synthesis processes. Its unique chemical properties may be harnessed to create innovative products and improve existing manufacturing techniques.
Used in Chemical Synthesis Processes:
1-(2,4-Dimethylallophanoyl)-4-(4-chlorophenyl)piperazine is used as a key intermediate in the synthesis of various chemical compounds. Its versatility and reactivity make it a valuable component in the creation of new molecules with specific properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80712-15-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,7,1 and 2 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 80712-15:
(7*8)+(6*0)+(5*7)+(4*1)+(3*2)+(2*1)+(1*5)=108
108 % 10 = 8
So 80712-15-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H19ClN4O2/c1-16-13(20)17(2)14(21)19-9-7-18(8-10-19)12-5-3-11(15)4-6-12/h3-6H,7-10H2,1-2H3,(H,16,20)