80714-26-7 Usage
Uses
Used in Pharmaceutical Development:
1-(6-CHLOROPYRIDIN-2-YL)-1H-[1,2,4]TRIAZOL-3-OL is used as a key intermediate in the synthesis of pharmaceutical drugs, leveraging its triazol-based structure and chloropyridinyl group to create novel therapeutic agents. Its unique chemical properties may contribute to the development of drugs with specific target affinities and biological activities.
Used in Chemical Synthesis:
In the chemical synthesis industry, 1-(6-CHLOROPYRIDIN-2-YL)-1H-[1,2,4]TRIAZOL-3-OL serves as a building block for the creation of other complex chemical compounds. Its reactivity and structural features make it a valuable component in the synthesis of various organic and inorganic molecules, potentially leading to new materials and applications.
Used in Research and Development:
1-(6-CHLOROPYRIDIN-2-YL)-1H-[1,2,4]TRIAZOL-3-OL is utilized in research settings to explore its potential properties and applications. Scientists and researchers may investigate its interactions with biological systems, its role in chemical reactions, and its potential use in the development of new technologies or industrial processes.
While the specific applications in different industries are not explicitly detailed in the provided materials, the potential uses of 1-(6-CHLOROPYRIDIN-2-YL)-1H-[1,2,4]TRIAZOL-3-OL in pharmaceutical development, chemical synthesis, and research and development are inferred based on its chemical structure and properties. Further study would be necessary to fully understand its capabilities and possible uses across various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 80714-26-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,7,1 and 4 respectively; the second part has 2 digits, 2 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 80714-26:
(7*8)+(6*0)+(5*7)+(4*1)+(3*4)+(2*2)+(1*6)=117
117 % 10 = 7
So 80714-26-7 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN4O/c8-5-2-1-3-6(10-5)12-4-9-7(13)11-12/h1-4H,(H,11,13)
