80722-12-9 Usage
Pyrrolidine derivative
A compound derived from pyrrolidine This indicates that the compound is based on the pyrrolidine structure, which is a four-membered heterocyclic ring containing one nitrogen atom.
Dodecyl chain
A 12-carbon alkyl chain This is a linear chain of 12 carbon atoms, which contributes to the compound's amphiphilic properties and potential use as a surfactant or emulsifier.
Phenyl group
A benzene ring This is an aromatic ring structure with delocalized electrons, which can contribute to the compound's stability and potential applications.
Carboxylic acid functional group
A -COOH group This polar functional group is responsible for the compound's acidity and potential use in the synthesis of pharmaceuticals.
Prodrug
Can be converted into an active pharmaceutical compound in the body This means that the compound can be further metabolized or modified in the body to produce the active therapeutic agent.
Therapeutic applications
Used in the synthesis of pharmaceuticals The compound can be used as a starting material or intermediate in the production of various drugs for different medical purposes.
Antimicrobial properties
Potential ability to inhibit or kill microorganisms This suggests that the compound may have applications in treating infections or preventing the growth of harmful microorganisms.
Anti-inflammatory properties
Potential ability to reduce inflammation This indicates that the compound may have applications in treating conditions characterized by inflammation, such as arthritis or allergies.
Amphiphilic
Both hydrophilic (water-loving) and hydrophobic (water-repelling) properties This allows the compound to act as a surfactant or emulsifier in various industrial and cosmetic products, stabilizing mixtures of water and oils.
Wide range of potential applications
Unique chemical structure and properties Due to its combination of functional groups and chemical properties, 1-dodecyl-5-oxo-2-phenylpyrrolidine-3-carboxylic acid has numerous potential uses in pharmaceuticals, industrial products, and cosmetics.
Check Digit Verification of cas no
The CAS Registry Mumber 80722-12-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,7,2 and 2 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 80722-12:
(7*8)+(6*0)+(5*7)+(4*2)+(3*2)+(2*1)+(1*2)=109
109 % 10 = 9
So 80722-12-9 is a valid CAS Registry Number.
InChI:InChI=1/C23H35NO3/c1-2-3-4-5-6-7-8-9-10-14-17-24-21(25)18-20(23(26)27)22(24)19-15-12-11-13-16-19/h11-13,15-16,20,22H,2-10,14,17-18H2,1H3,(H,26,27)