80789-70-4 Usage
Uses
Used in Pharmaceutical Industry:
6-amino-2-phenylquinolin-4-ol is used as a pharmaceutical compound for its antitubercular and anti-inflammatory properties. It has been studied for its potential to treat tuberculosis and reduce inflammation in the body.
Used in Coordination Chemistry:
6-amino-2-phenylquinolin-4-ol is used as a chelating agent in the development of complex coordination compounds. Its ability to form stable complexes with metal ions makes it a valuable component in the synthesis of new materials with potential applications in various fields.
Used in Chemical and Biological Research:
6-amino-2-phenylquinolin-4-ol is used as a fluorescent labeling agent in chemical and biological research. Its fluorescent properties allow for the tracking and visualization of specific molecules or cellular structures, aiding in the study of biological processes and the development of new diagnostic tools.
Used in Fluorescent Imaging:
6-amino-2-phenylquinolin-4-ol is used as a fluorescent imaging agent in various applications, such as cell biology, molecular biology, and materials science. Its ability to emit fluorescence upon excitation makes it a useful tool for visualizing and analyzing samples at the microscopic level.
Check Digit Verification of cas no
The CAS Registry Mumber 80789-70-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,7,8 and 9 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 80789-70:
(7*8)+(6*0)+(5*7)+(4*8)+(3*9)+(2*7)+(1*0)=164
164 % 10 = 4
So 80789-70-4 is a valid CAS Registry Number.
InChI:InChI=1/C15H12N2O/c16-11-6-7-13-12(8-11)15(18)9-14(17-13)10-4-2-1-3-5-10/h1-9H,16H2,(H,17,18)
