808144-34-5 Usage
Uses
Used in Pharmaceutical Industry:
6,7,8-Trifluoro-2-tetralone is used as an intermediate compound for the synthesis of various pharmaceutical drugs. Its unique chemical structure allows for the development of new medications with potential therapeutic applications.
Used in Biochemical Research:
6,7,8-Trifluoro-2-tetralone is used as a research tool in biochemical studies, where its properties and reactivity can be investigated to understand its potential interactions with biological systems and its role in various biochemical processes.
Used in Chemical Synthesis:
6,7,8-Trifluoro-2-tetralone is used as a building block in the synthesis of more complex organic compounds, particularly in the field of organic chemistry. Its presence of fluorine atoms can influence the reactivity and properties of the resulting compounds, making it a valuable component in the synthesis of novel materials.
Check Digit Verification of cas no
The CAS Registry Mumber 808144-34-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,0,8,1,4 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 808144-34:
(8*8)+(7*0)+(6*8)+(5*1)+(4*4)+(3*4)+(2*3)+(1*4)=155
155 % 10 = 5
So 808144-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H7F3O/c11-8-3-5-1-2-6(14)4-7(5)9(12)10(8)13/h3H,1-2,4H2
