80830-37-1 Usage
Uses
Used in Dye Industry:
2,5-Dimethoxy-4-nitroazobenzene is used as a dye due to its color-changing properties, which are triggered by different chemical conditions. This characteristic makes it a valuable component in the formulation of dyes that respond to specific chemical environments.
Used in Chemical Research:
In the field of chemical research, 2,5-Dimethoxy-4-nitroazobenzene is employed as a reagent in various chemical reactions. Its presence can aid in the synthesis of new compounds and contribute to the understanding of reaction mechanisms.
Used in Synthesis of Organic Compounds:
2,5-Dimethoxy-4-nitroazobenzene is utilized as an intermediate in the synthesis of other organic compounds. Its structural components, including the nitro and azo groups, facilitate the creation of a diverse range of chemical products.
Used in Chemical Reactions:
As a reagent, 2,5-Dimethoxy-4-nitroazobenzene is involved in a variety of chemical reactions. Its participation can lead to the formation of new compounds and can be instrumental in advancing the study of chemical processes.
Check Digit Verification of cas no
The CAS Registry Mumber 80830-37-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,8,3 and 0 respectively; the second part has 2 digits, 3 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 80830-37:
(7*8)+(6*0)+(5*8)+(4*3)+(3*0)+(2*3)+(1*7)=121
121 % 10 = 1
So 80830-37-1 is a valid CAS Registry Number.
InChI:InChI=1/C14H13N3O4/c1-20-13-9-12(17(18)19)14(21-2)8-11(13)16-15-10-6-4-3-5-7-10/h3-9H,1-2H3/b16-15+
