80883-54-1 Usage
General Description
7-Dimethylaminocoumarin-4-acetic acid is a synthetic compound derived from coumarin, a natural substance found in some plants. It is a fluorescent dye that is widely used in biological and chemical research as a tracer or indicator due to its ability to emit strong blue fluorescence when exposed to ultraviolet light. The 7-Dimethylaminocoumarin-4-acetic acid is particularly valuable in the study of cellular processes, as it can be used to visualize and track the movement and distribution of specific molecules within living cells. Its fluorescent properties also make it useful in medical diagnostics, such as in the detection of certain diseases or in the development of imaging agents for medical imaging. Additionally, the chemical structure of 7-Dimethylaminocoumarin-4-acetic acid can be modified to create derivatives with specific fluorescent properties for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 80883-54-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,8,8 and 3 respectively; the second part has 2 digits, 5 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 80883-54:
(7*8)+(6*0)+(5*8)+(4*8)+(3*3)+(2*5)+(1*4)=151
151 % 10 = 1
So 80883-54-1 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO4/c1-14(2)9-3-4-10-8(5-12(15)16)6-13(17)18-11(10)7-9/h3-4,6-7H,5H2,1-2H3,(H,15,16)
