80902-01-8 Usage
Uses
Used in Chemical Synthesis:
Haloquinone is used as a precursor for the synthesis of other chemicals due to its high reactivity and ability to participate in various chemical reactions.
Used in Organic Reactions:
Haloquinone is used as a catalyst in organic reactions, facilitating the conversion of reactants to products and improving the efficiency of the reaction process.
Used in Biological Processes:
Haloquinone is used as an electron carrier in biological processes, playing a crucial role in energy transfer and metabolic reactions.
Used in Pharmaceutical Development:
Haloquinone is being studied for its potential pharmacological properties, such as antioxidant and cytotoxic effects. These properties could make haloquinone valuable in the development of new drugs and therapies, particularly for conditions that require antioxidant or cytotoxic agents.
Used in Research Applications:
Haloquinone is utilized in research applications to explore its chemical properties, reactivity, and potential applications in various fields, including material science, catalysis, and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 80902-01-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,9,0 and 2 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 80902-01:
(7*8)+(6*0)+(5*9)+(4*0)+(3*2)+(2*0)+(1*1)=108
108 % 10 = 8
So 80902-01-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H12O5/c1-7-10(8(2)18)6-11-9-4-3-5-12(19)13(9)16(21)17(22)14(11)15(7)20/h3-6,19-20H,1-2H3
