809236-49-5 Usage
Description
Phenol, 4-[(3-methylcyclopentyl)oxy](9CI) is a chemical compound belonging to the phenol family, characterized by a hydroxyl group (-OH) attached to a benzene ring. It has a unique structure with a cyclopentyl group featuring a methyl substituent attached to the oxygen atom. Phenol, 4-[(3-methylcyclopentyl)oxy](9CI), with the molecular formula C12H16O2, is utilized in various applications, including organic synthesis, pharmaceutical and agrochemical production, and the creation of flavors and fragrances.
Uses
Used in Organic Synthesis:
Phenol, 4-[(3-methylcyclopentyl)oxy](9CI) serves as a key intermediate in organic synthesis, facilitating the development of various chemical compounds and materials. Its unique structure allows it to participate in a range of chemical reactions, making it a valuable component in the synthesis process.
Used in Pharmaceutical Production:
As a building block, Phenol, 4-[(3-methylcyclopentyl)oxy](9CI) contributes to the manufacturing of pharmaceuticals. Its specific structure can be incorporated into drug molecules, potentially enhancing their efficacy and selectivity in treating various medical conditions.
Used in Agrochemical Production:
Phenol, 4-[(3-methylcyclopentyl)oxy](9CI) also plays a role in the production of agrochemicals, which are essential for agriculture to protect crops from pests and diseases. Its chemical properties make it suitable for use in the development of effective and targeted agrochemical products.
Used in Flavors and Fragrances Industry:
Phenol, 4-[(3-methylcyclopentyl)oxy](9CI) finds application in the creation of flavors and fragrances, adding unique scents and tastes to various consumer products. Its ability to impart specific olfactory and gustatory characteristics makes it a valuable ingredient in this industry.
Safety Precautions:
Due to its potentially hazardous nature, it is crucial to exercise proper safety measures when handling and using Phenol, 4-[(3-methylcyclopentyl)oxy](9CI). This includes adhering to recommended guidelines and protocols to minimize risks and ensure the safe utilization of this chemical compound in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 809236-49-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,0,9,2,3 and 6 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 809236-49:
(8*8)+(7*0)+(6*9)+(5*2)+(4*3)+(3*6)+(2*4)+(1*9)=175
175 % 10 = 5
So 809236-49-5 is a valid CAS Registry Number.
InChI:InChI=1/C12H16O2/c1-9-2-5-12(8-9)14-11-6-3-10(13)4-7-11/h3-4,6-7,9,12-13H,2,5,8H2,1H3