80953-62-4 Usage
Uses
Used in Pharmaceutical Industry:
1-Benzyl hydrogen 5-oxopyrrolidine-1,2-dicarboxylate is used as a precursor in the synthesis of pharmaceuticals for its ability to contribute to the development of new drugs with potential therapeutic applications.
Used in Medicinal Chemistry Research:
1-Benzyl hydrogen 5-oxopyrrolidine-1,2-dicarboxylate is used as a research chemical in medicinal chemistry to explore its potential in creating new drug candidates with various therapeutic properties.
Used in Drug Development:
1-Benzyl hydrogen 5-oxopyrrolidine-1,2-dicarboxylate is used as a key component in drug development due to its potential antihypertensive and antithrombotic properties, which can lead to the creation of innovative treatments for cardiovascular conditions.
Used in Medical Research:
1-Benzyl hydrogen 5-oxopyrrolidine-1,2-dicarboxylate is utilized in medical research to study its potential applications in therapeutics and to understand its interactions within biological systems.
Check Digit Verification of cas no
The CAS Registry Mumber 80953-62-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,9,5 and 3 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 80953-62:
(7*8)+(6*0)+(5*9)+(4*5)+(3*3)+(2*6)+(1*2)=144
144 % 10 = 4
So 80953-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO5/c15-11-7-6-10(12(16)17)14(11)13(18)19-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,16,17)
