80953-62-4 Usage
General Description
1-Benzyl hydrogen 5-oxopyrrolidine-1,2-dicarboxylate is a chemical compound commonly used as a precursor in the synthesis of pharmaceuticals and research chemicals. It is a derivative of pyrrolidine dicarboxylic acid and is often employed in medicinal chemistry for the development of new drugs. 1-Benzyl hydrogen 5-oxopyrrolidine-1,2-dicarboxylate has been studied for its potential therapeutic applications, including antihypertensive and antithrombotic properties. Its molecular structure contains a benzyl group and a pyrrolidine ring with two carboxylate groups, giving it multiple functional groups for chemical reactivity. Overall, 1-Benzyl hydrogen 5-oxopyrrolidine-1,2-dicarboxylate plays a critical role in drug development and has potential applications in medical research and pharmaceutical industry.
Check Digit Verification of cas no
The CAS Registry Mumber 80953-62-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,0,9,5 and 3 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 80953-62:
(7*8)+(6*0)+(5*9)+(4*5)+(3*3)+(2*6)+(1*2)=144
144 % 10 = 4
So 80953-62-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H13NO5/c15-11-7-6-10(12(16)17)14(11)13(18)19-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,16,17)
