81038-44-0 Usage
Uses
Used in Pharmaceutical Industry:
3-Bromo-4-Hydroxy-5-Methoxyphenylacetonitrile is used as an intermediate in the synthesis of a wide range of medicinal and pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Agrochemical Production:
In addition to its pharmaceutical applications, 3-Bromo-4-Hydroxy-5-Methoxyphenylacetonitrile is also used as an intermediate in the production of agrochemicals. Its versatility in chemical synthesis enables the creation of various agrochemicals that can be used in agriculture to protect crops and enhance yield.
Used in Specialty Chemicals Production:
3-Bromo-4-Hydroxy-5-Methoxyphenylacetonitrile's chemical properties make it a valuable intermediate in the production of specialty chemicals. These specialty chemicals can be used in various industries, such as cosmetics, coatings, and materials science, for their unique properties and applications.
Check Digit Verification of cas no
The CAS Registry Mumber 81038-44-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,0,3 and 8 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 81038-44:
(7*8)+(6*1)+(5*0)+(4*3)+(3*8)+(2*4)+(1*4)=110
110 % 10 = 0
So 81038-44-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H8BrNO2/c1-13-8-5-6(2-3-11)4-7(10)9(8)12/h4-5,12H,2H2,1H3
