81067-42-7 Usage
Uses
Used in Pesticide Industry:
3,5-Dibromo-1,2-dichlorobenzene is used as a pesticide for controlling various pests that can damage crops and affect agricultural productivity. Its chemical properties allow it to be effective against a range of pests, making it a valuable tool in protecting crops and ensuring food security.
Used in Fumigant Applications:
In the field of fumigation, 3,5-dibromo-1,2-dichlorobenzene serves as a potent fumigant, utilized for eliminating pests and pathogens in various settings such as storage facilities, greenhouses, and soil treatment. Its effectiveness in penetrating and killing pests and microorganisms makes it a preferred choice for maintaining the quality and safety of stored products and agricultural produce.
It is crucial to follow safety guidelines and take necessary precautions when handling 3,5-dibromo-1,2-dichlorobenzene to minimize its potential harmful effects on human health and the environment.
Check Digit Verification of cas no
The CAS Registry Mumber 81067-42-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,0,6 and 7 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 81067-42:
(7*8)+(6*1)+(5*0)+(4*6)+(3*7)+(2*4)+(1*2)=117
117 % 10 = 7
So 81067-42-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Br2Cl2/c7-3-1-4(8)6(10)5(9)2-3/h1-2H
