81067-44-9 Usage
Uses
Used in Pharmaceutical Industry:
1-Bromo-3,5-dichloro-2-iodobenzene is used as a key intermediate in the synthesis of various pharmaceuticals. Its unique halogenated structure allows for the development of new drugs with improved therapeutic properties and efficacy.
Used in Agrochemical Industry:
In the agrochemical sector, 1-bromo-3,5-dichloro-2-iodobenzene serves as an essential building block for the production of agrochemicals. Its incorporation into these compounds can enhance their pesticidal or herbicidal activities, contributing to more effective crop protection.
Used in Specialty Chemicals:
1-Bromo-3,5-dichloro-2-iodobenzene is utilized as a versatile intermediate in the synthesis of specialty chemicals, including dyes, pigments, and polymers. Its presence in these compounds can improve their color intensity, stability, and other performance characteristics.
Used in Organic Synthesis:
As a valuable compound for organic synthesis, 1-bromo-3,5-dichloro-2-iodobenzene is employed in various chemical reactions to form a wide range of organic compounds. Its unique reactivity allows for the creation of new molecules with diverse applications in various industries.
Used in Chemical Research:
In the field of chemical research, 1-bromo-3,5-dichloro-2-iodobenzene is an important compound for studying the effects of halogenation on aromatic systems. Its unique properties provide insights into the reactivity and behavior of halogenated aromatic compounds, contributing to the advancement of chemical knowledge and innovation.
Check Digit Verification of cas no
The CAS Registry Mumber 81067-44-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,0,6 and 7 respectively; the second part has 2 digits, 4 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 81067-44:
(7*8)+(6*1)+(5*0)+(4*6)+(3*7)+(2*4)+(1*4)=119
119 % 10 = 9
So 81067-44-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H2BrCl2I/c7-4-1-3(8)2-5(9)6(4)10/h1-2H
81067-44-9Relevant academic research and scientific papers
Jensen, Thomas,Pedersen, Henrik,Bang-Andersen, Benny,Madsen, Robert,Jorgensen, Morten
, p. 888 - 890 (2008)
(Chemical Equation Presented) Two for the price of one: A Pd/dppf-based catalyst provides access to the title compounds from 1,2-dihalogenated aromatic compounds and allylic amines in a single reaction flask. The initial aryl amination step occurs with excellent selectivity for the aryl iodide to ensure the formation of a single indole regioisomer, which can be functionalized in situ by N-arylation (see scheme). dba = dibenzylideneacetone, dppf = 1,1′-bis(diphenylphospanyl)ferrocene.
