81067-45-0 Usage
Uses
Used in Organic Synthesis:
1-CHLORO-3,5-DIBROMO-2-IODOBENZENE is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for versatile chemical reactions, making it a valuable building block in the creation of complex organic molecules.
Used in Pharmaceutical Production:
In the pharmaceutical industry, 1-CHLORO-3,5-DIBROMO-2-IODOBENZENE serves as an essential intermediate for the production of various drugs and medicinal compounds. Its reactivity and structural features enable the development of novel pharmaceuticals with specific therapeutic properties.
Used in Agrochemical Manufacturing:
1-CHLORO-3,5-DIBROMO-2-IODOBENZENE is utilized in the synthesis of agrochemicals, such as pesticides and herbicides. Its unique chemical structure contributes to the development of effective and targeted agrochemicals for agricultural applications.
Used as a Research Reagent:
In research and development, 1-CHLORO-3,5-DIBROMO-2-IODOBENZENE is employed as a reagent for various chemical reactions and experiments. Its distinct properties make it suitable for exploring new reaction pathways and understanding the behavior of halogenated aromatic compounds.
Used in Fine Chemicals Production:
1-CHLORO-3,5-DIBROMO-2-IODOBENZENE is also used in the production of fine chemicals, which are high-purity chemicals used in various industries, including cosmetics, fragrances, and specialty chemicals. Its unique structure and reactivity contribute to the synthesis of high-quality fine chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 81067-45-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,0,6 and 7 respectively; the second part has 2 digits, 4 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 81067-45:
(7*8)+(6*1)+(5*0)+(4*6)+(3*7)+(2*4)+(1*5)=120
120 % 10 = 0
So 81067-45-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H2Br2ClI/c7-3-1-4(8)6(10)5(9)2-3/h1-2H
