81128-01-0 Usage
General Description
2,4-DIPHENYL-5,6,7,8-TETRAHYDROCHROMENYLIUM TRIFLUOROMETHANESULPHONATE is a complex chemical compound with a long name that consists of a chromenylium cation and a trifluoromethanesulphonate anion. 2,4-DIPHENYL-5,6,7,8-TETRAHYDROCHROMENYLIUM TRIFLUOROMETHANESULPHONATE has potential applications in organic synthesis and material science due to its unique structure and reactivity. It is often used as a reagent in organic chemistry reactions and has been studied for its potential use in pharmaceutical research and drug development. Its precise properties and potential uses depend on its structure and behavior in different chemical environments. Overall, 2,4-DIPHENYL-5,6,7,8-TETRAHYDROCHROMENYLIUM TRIFLUOROMETHANESULPHONATE is a complex and versatile chemical compound with potential applications in various fields of science and industry.
Check Digit Verification of cas no
The CAS Registry Mumber 81128-01-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,1,2 and 8 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 81128-01:
(7*8)+(6*1)+(5*1)+(4*2)+(3*8)+(2*0)+(1*1)=100
100 % 10 = 0
So 81128-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C21H19O.CHF3O3S/c1-3-9-16(10-4-1)19-15-21(17-11-5-2-6-12-17)22-20-14-8-7-13-18(19)20;2-1(3,4)8(5,6)7/h1-6,9-12,15H,7-8,13-14H2;(H,5,6,7)/q+1;/p-1
81128-01-0Relevant articles and documents
The Chemistry of Some Bicyclic Pyridinium Anhydrobases
Katritzky, Alan R.,Ueroegdi, Laszlo,Patel, Ranjan C.
, p. 1349 - 1354 (2007/10/02)
The anhydrobase from 5,6,7,8-tetrahydro-2,4-diphenyl-1-p-tolylquinolinium reacts with C-, N-, and S-electrophiles to form adducts and new anhydrobases.The tautomeric structures of the adducts are deduced from spectral evidence.
