81254-00-4 Usage
Molecular structure
2,7-Bis(2-(dimethylamino)ethyl)benzo(lmn)(3,8)phenanthroline-1,3,6,8(2 H,7H)-tetrone dihydrobromide consists of a benzo(lmn)(3,8)phenanthroline core structure with two dimethylaminoethyl groups attached at the 2 and 7 positions, and a tetrone dihydrobromide moiety.
Functional groups
The compound contains multiple functional groups, including dimethylaminoethyl groups, a tetrone group, and dihydrobromide ions.
Complexity
The compound has a complex structure, which may contribute to its unique properties and potential applications.
Applications
Due to its complex structure, 2,7-Bis(2-(dimethylamino)ethyl)benzo(lmn)(3,8)phenanthroline-1,3,6,8(2 H,7H)-tetrone dihydrobromide may have applications in various fields such as organic synthesis, chemical research, and pharmaceuticals.
Safety precautions
It is important to handle this chemical with caution as it may have potential health and safety hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 81254-00-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,2,5 and 4 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 81254-00:
(7*8)+(6*1)+(5*2)+(4*5)+(3*4)+(2*0)+(1*0)=104
104 % 10 = 4
So 81254-00-4 is a valid CAS Registry Number.
InChI:InChI=1/C22H24N4O4.2BrH/c1-23(2)9-11-25-19(27)13-5-7-15-18-16(8-6-14(17(13)18)20(25)28)22(30)26(21(15)29)12-10-24(3)4;;/h5-8H,9-12H2,1-4H3;2*1H