81258-10-8 Usage
Chemical structure
A fused tricyclic ring system containing a pyranoindole moiety.
Derivative of
Synthetic derivative of the naturally occurring compound harmine.
Natural occurrence
Found in various plants such as Peganum harmala.
Pharmacological properties
Studied for its potential as a monoamine oxidase inhibitor.
Potential therapeutic applications
Possible use in the treatment of various neurological and psychiatric disorders.
Research significance
Unique structure and biological activities make it a compelling target for further research and development.
Check Digit Verification of cas no
The CAS Registry Mumber 81258-10-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,2,5 and 8 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 81258-10:
(7*8)+(6*1)+(5*2)+(4*5)+(3*8)+(2*1)+(1*0)=118
118 % 10 = 8
So 81258-10-8 is a valid CAS Registry Number.
InChI:InChI=1/C12H13NO3/c1-15-9-6-7-2-4-13-11(7)10-8(14)3-5-16-12(9)10/h2,4,6,8,13-14H,3,5H2,1H3