81262-06-8 Usage
Chemical class
Diaziridines Three-membered cyclic compounds containing two nitrogen atoms and one carbon atom.
1,2-dimethyl substituent
Two methyl groups attached to adjacent carbon atoms in the ring.
4-chlorophenyl group
A phenyl ring with a chlorine atom attached to the fourth carbon.
Photoaffinity labeling
Used to study biomolecule interactions by forming covalent bonds upon light exposure.
Crosslinking studies
Forms covalent bonds with biomolecules, such as proteins, nucleic acids, and lipids, upon light-induced reactions.
Antitumor activity
Investigated for its potential as an anti-cancer agent.
Reagent in organic synthesis
Utilized in various chemical reactions due to its unique reactivity.
Safety precautions
Handle with care due to potential hazardous and toxic properties.
Check Digit Verification of cas no
The CAS Registry Mumber 81262-06-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,2,6 and 2 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 81262-06:
(7*8)+(6*1)+(5*2)+(4*6)+(3*2)+(2*0)+(1*6)=108
108 % 10 = 8
So 81262-06-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H11ClN2/c1-11-9(12(11)2)7-3-5-8(10)6-4-7/h3-6,9H,1-2H3
