81310-60-3 Usage
Uses
Used in Pharmaceutical Industry:
4-PIPERIDIN-3-YLMETHYL-MORPHOLINE is used as a building block for the synthesis of various pharmaceuticals due to its potential to act as a ligand for different biological targets. Its structural features allow it to be incorporated into the design of new drugs, enhancing their interaction with specific receptors or enzymes, thereby improving their therapeutic efficacy.
Used in Organic Synthesis:
4-PIPERIDIN-3-YLMETHYL-MORPHOLINE is used as a reagent in organic synthesis to introduce the piperidylmethyl group into other organic molecules. This functional group can impart specific properties to the resulting compounds, such as increased solubility, stability, or bioavailability, which are crucial for their performance in various applications.
Used in Medicinal Chemistry:
4-PIPERIDIN-3-YLMETHYL-MORPHOLINE is used as a precursor for the synthesis of biologically active molecules in medicinal chemistry. Its unique structural features enable the development of novel compounds with potential therapeutic applications, contributing to the discovery of new drugs and treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 81310-60-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,3,1 and 0 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 81310-60:
(7*8)+(6*1)+(5*3)+(4*1)+(3*0)+(2*6)+(1*0)=93
93 % 10 = 3
So 81310-60-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H20N2O/c1-2-10(8-11-3-1)9-12-4-6-13-7-5-12/h10-11H,1-9H2
