81397-85-5 Usage
Uses
Used in Pharmaceutical Synthesis:
Bromindione is utilized as an intermediate in the synthesis of pharmaceuticals, contributing to the development of new drugs and therapeutic agents. Its ability to inhibit organic anion transporting polypeptides makes it a valuable component in the creation of medications that require specific absorption and disposition profiles in the body.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, Bromindione is employed for its potential to influence the transport of organic anions, which can be instrumental in the design and optimization of drug molecules with improved pharmacokinetic properties.
Used in Biochemistry:
Bromindione's role in inhibiting organic anion transporting polypeptides is also significant in biochemistry, where it can be used to study the mechanisms of drug transport and develop a deeper understanding of the processes involved in drug absorption and disposition.
Used in Pharmacology:
Pharmacologists use Bromindione to explore its effects on drug absorption and disposition, potentially leading to advancements in drug delivery systems and the optimization of drug efficacy and safety.
Used in Fungicide Development:
Bromindione has been studied for its potential as a fungicide, indicating its use in the development of antifungal agents to combat fungal infections and protect crops.
Used in Organic Synthesis Reactions:
As a reagent in organic synthesis, Bromindione is employed to facilitate various chemical reactions, contributing to the synthesis of complex organic compounds for research and industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 81397-85-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,3,9 and 7 respectively; the second part has 2 digits, 8 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 81397-85:
(7*8)+(6*1)+(5*3)+(4*9)+(3*7)+(2*8)+(1*5)=155
155 % 10 = 5
So 81397-85-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H9BrO2/c16-10-7-5-9(6-8-10)13-14(17)11-3-1-2-4-12(11)15(13)18/h1-8,17H