81484-99-3 Usage
Chemical structure
A complex chemical compound with a long and specific name, consisting of an imidazolidin-4-one derivative with a thioxo group and a pyrrolidinylidene substituent.
Functional groups
Imidazolidin-4-one, thioxo, and pyrrolidinylidene groups.
Potential applications
As a potential drug candidate, it may have pharmacological properties, although further research is needed to determine its exact uses and effects.
Fields of study
The compound's structure and properties make it an interesting subject for study in the fields of medicinal chemistry and drug development.
Research status
Further research is required to fully understand the compound's pharmacological properties, potential applications, and effects on biological systems.
Structural complexity
The compound's structure is characterized by its multiple methyl groups, a thioxo group, and a pyrrolidinylidene substituent, which contribute to its unique properties and potential applications.
Chemical reactivity
The compound's reactivity may be influenced by the presence of its various functional groups, which could potentially participate in various chemical reactions.
Synthesis
The synthesis of 1,3-dimethyl-2-thioxo-5-[(1,5,5-trimethyl-2-pyrrolidinylidene)ethylidene]imidazolidin-4-one may involve multiple steps, including the formation of the imidazolidin-4-one core, introduction of the thioxo group, and attachment of the pyrrolidinylidene substituent.
Stability
The stability of the compound under various conditions (e.g., temperature, pH, etc.) may be an important factor to consider in its potential applications and further research.
Check Digit Verification of cas no
The CAS Registry Mumber 81484-99-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,4,8 and 4 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 81484-99:
(7*8)+(6*1)+(5*4)+(4*8)+(3*4)+(2*9)+(1*9)=153
153 % 10 = 3
So 81484-99-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H21N3OS/c1-14(2)9-8-10(17(14)5)6-7-11-12(18)16(4)13(19)15(11)3/h6-7H,8-9H2,1-5H3/b10-6-,11-7-
