81493-98-3 Usage
General Description
The chemical "H-ARG-ARG-LEU-ILE- GLU-ASP-ASN-GLU-TYR-THR-ALA-ARG-GLY-OH" is a peptide composed of the amino acids arginine, leucine, isoleucine, glutamic acid, asparagine, tyrosine, threonine, alanine, and arginine, with a carboxy-terminal glycine. This peptide sequence is arranged in a specific order, with each amino acid linked together through peptide bonds. Peptides such as this one can have various biological activities, including acting as signaling molecules, neurotransmitters, or hormones, and may have potential therapeutic applications due to their ability to interact with specific receptors or enzymes in the body.
Check Digit Verification of cas no
The CAS Registry Mumber 81493-98-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,4,9 and 3 respectively; the second part has 2 digits, 9 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 81493-98:
(7*8)+(6*1)+(5*4)+(4*9)+(3*3)+(2*9)+(1*8)=153
153 % 10 = 3
So 81493-98-3 is a valid CAS Registry Number.
InChI:InChI=1/C66H109N23O23/c1-7-31(4)50(88-60(109)41(25-30(2)3)84-55(104)38(13-10-24-77-66(73)74)81-53(102)36(67)11-8-22-75-64(69)70)62(111)83-40(19-21-47(95)96)57(106)87-44(28-48(97)98)59(108)86-43(27-45(68)92)58(107)82-39(18-20-46(93)94)56(105)85-42(26-34-14-16-35(91)17-15-34)61(110)89-51(33(6)90)63(112)79-32(5)52(101)80-37(12-9-23-76-65(71)72)54(103)78-29-49(99)100/h14-17,30-33,36-44,50-51,90-91H,7-13,18-29,67H2,1-6H3,(H2,68,92)(H,78,103)(H,79,112)(H,80,101)(H,81,102)(H,82,107)(H,83,111)(H,84,104)(H,85,105)(H,86,108)(H,87,106)(H,88,109)(H,89,110)(H,93,94)(H,95,96)(H,97,98)(H,99,100)(H4,69,70,75)(H4,71,72,76)(H4,73,74,77)