81494-02-2 Usage
Chemical structure
A derivative of 1,3,5-triazin-2-one with an ethylamino group at the 4-position and a propylamino group at the 6-position.
Organic synthesis
As a building block for the synthesis of various heterocyclic compounds.
Pharmaceutical research
As a starting material in the development of new drug candidates.
Biological activities
Subject to further research and investigation.
Unique properties
The presence of ethylamino and propylamino groups at specific positions in the molecule may contribute to its potential applications in organic synthesis and pharmaceutical research.
Check Digit Verification of cas no
The CAS Registry Mumber 81494-02-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,4,9 and 4 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 81494-02:
(7*8)+(6*1)+(5*4)+(4*9)+(3*4)+(2*0)+(1*2)=132
132 % 10 = 2
So 81494-02-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H15N5O/c1-3-5-10-7-11-6(9-4-2)12-8(14)13-7/h3-5H2,1-2H3,(H3,9,10,11,12,13,14)