81531-58-0 Usage
General Description
2-[2-(diethylamino)ethyl]-9-hydroxy-5,11-dimethyl-6H-pyrido[4,3-b]carbazolium acetate is a chemical compound with a complex molecular structure. It contains a pyrido[4,3-b]carbazole core with two substituents - a diethylaminoethyl group and a hydroxy-methyl-methyl group. The presence of the acetate group indicates that it is an acetate salt of the compound. This chemical compound may have pharmaceutical or biological applications due to its structural features and potential interactions with biological systems. However, additional research would be needed to fully understand the properties and potential uses of this compound.
Check Digit Verification of cas no
The CAS Registry Mumber 81531-58-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,5,3 and 1 respectively; the second part has 2 digits, 5 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 81531-58:
(7*8)+(6*1)+(5*5)+(4*3)+(3*1)+(2*5)+(1*8)=120
120 % 10 = 0
So 81531-58-0 is a valid CAS Registry Number.
InChI:InChI=1/C23H27N3O.C2H4O2/c1-5-25(6-2)11-12-26-10-9-18-16(4)23-22(15(3)20(18)14-26)19-13-17(27)7-8-21(19)24-23;1-2(3)4/h7-10,13-14,27H,5-6,11-12H2,1-4H3;1H3,(H,3,4)