81562-77-8 Usage
Uses
Used in Pharmaceutical Industry:
(4AS,8AS)-OCTAHYDROISOQUINOLIN-4A(2H)-OL is used as a chemical intermediate for the synthesis of various pharmaceuticals and organic compounds. Its role in the development of new drugs is significant due to its ability to be modified into derivative compounds with potential biological and pharmacological activities.
Used in Antiviral Applications:
As a precursor to derivative compounds, (4AS,8AS)-OCTAHYDROISOQUINOLIN-4A(2H)-OL is used in the research and development of antiviral agents. Its potential to inhibit viral replication and reduce the severity of viral infections makes it a valuable component in the creation of new antiviral medications.
Used in Anti-inflammatory Applications:
(4AS,8AS)-OCTAHYDROISOQUINOLIN-4A(2H)-OL is utilized in the synthesis of compounds that exhibit anti-inflammatory properties. These compounds can be used to alleviate inflammation and associated symptoms, contributing to the development of treatments for various inflammatory conditions.
Used in Antitumor Applications:
In the field of oncology, (4AS,8AS)-OCTAHYDROISOQUINOLIN-4A(2H)-OL is used as a starting point for creating compounds with antitumor capabilities. Its potential to inhibit tumor growth and proliferation makes it a promising component in the development of new cancer therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 81562-77-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,5,6 and 2 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 81562-77:
(7*8)+(6*1)+(5*5)+(4*6)+(3*2)+(2*7)+(1*7)=138
138 % 10 = 8
So 81562-77-8 is a valid CAS Registry Number.
InChI:InChI=1/C9H17NO/c11-9-4-2-1-3-8(9)7-10-6-5-9/h8,10-11H,1-7H2/t8-,9-/m0/s1