81595-00-8 Usage
Uses
Used in Pharmaceutical Industry:
(5-P-TOLYL-TETRAZOL-2-YL)-ACETIC ACID is used as a pharmaceutical intermediate for the synthesis of various drugs and compounds. Its tetrazole structure and hydrophobic tolyl group contribute to its potential as a building block in drug development, enhancing the biological potency and activity of the resulting pharmaceuticals.
Used in Medicinal Chemistry Research:
(5-P-TOLYL-TETRAZOL-2-YL)-ACETIC ACID is utilized in medicinal chemistry research to explore its diverse biological activities and potential applications in the development of new therapeutic agents. Its unique structure allows researchers to investigate its interactions with biological targets and its potential role in treating various diseases and conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 81595-00-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,5,9 and 5 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 81595-00:
(7*8)+(6*1)+(5*5)+(4*9)+(3*5)+(2*0)+(1*0)=138
138 % 10 = 8
So 81595-00-8 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N4O2/c1-7-2-4-8(5-3-7)10-11-13-14(12-10)6-9(15)16/h2-5H,6H2,1H3,(H,15,16)
81595-00-8Relevant academic research and scientific papers
Discovery, synthesis and characterization of a series of (1-alkyl-3-methyl-1H-pyrazol-5-yl)-2-(5-aryl-2H-tetrazol-2-yl)acetamides as novel GIRK1/2 potassium channel activators
Sharma, Swagat,Kozek, Krystian A.,Abney, Kristopher K.,Kumar, Sushil,Gautam, Nagsen,Alnouti, Yazen,David Weaver,Hopkins, Corey R.
, p. 791 - 796 (2019/02/06)
The present study describes the discovery and characterization of a series of 5-aryl-2H-tetrazol-3-ylacetamides as G protein-gated inwardly-rectifying potassium (GIRK) channels activators. Working from an initial hit discovered during a high-throughput screening campaign, we identified a tetrazole scaffold that shifts away from the previously reported urea-based scaffolds while remaining effective GIRK1/2 channel activators. In addition, we evaluated the compounds in Tier 1 DMPK assays and have identified a (3-methyl-1H-pyrazol-1-yl)tetrahydrothiophene-1,1-dioxide head group that imparts interesting and unexpected microsomal stability compared to previously-reported pyrazole head groups.
