81645-09-2 Usage
Uses
Used in Pharmaceutical Industry:
Lavendamycin is used as an antibiotic for its potent antibacterial properties, targeting a variety of pathogenic bacteria and contributing to the development of new medications to combat drug-resistant infections.
Used in Antifungal Applications:
Lavendamycin is utilized as an antifungal agent, exhibiting strong activity against various pathogenic fungi, which makes it a potential candidate for the development of new antifungal medications to treat fungal infections.
Used in Drug Development:
Lavendamycin is employed in the research and development of new pharmaceuticals, given its unique chemical structure and biological activity, which can lead to the creation of innovative treatments for bacterial and fungal infections.
Check Digit Verification of cas no
The CAS Registry Mumber 81645-09-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,6,4 and 5 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 81645-09:
(7*8)+(6*1)+(5*6)+(4*4)+(3*5)+(2*0)+(1*9)=132
132 % 10 = 2
So 81645-09-2 is a valid CAS Registry Number.
InChI:InChI=1/C22H14N4O4/c1-9-16-10-4-2-3-5-13(10)24-20(16)19(26-17(9)22(29)30)14-7-6-11-15(27)8-12(23)21(28)18(11)25-14/h2-8,24H,23H2,1H3,(H,29,30)