81701-13-5 Usage
General Description
TRANS,TRANS-4-FLUOROPHENYL 4''-PROPYLBICYCLOHEXYL-4-CARBOXYLATE is a chemical compound with a molecular formula C30H33FO2. It is a ester derivative of bicyclohexyl and contains a 4-fluorophenyl group and a 4-propyl substituent. TRANS,TRANS-4-FLUOROPHENYL 4''-PROPYLBICYCLOHEXYL-4-CARBOXYLATE is often used in the pharmaceutical industry as a building block for the synthesis of various drug candidates and pharmacological targets. It has potential therapeutic applications due to its ability to interact with biological systems and modulate specific molecular targets. Additionally, its unique chemical structure and properties make it a valuable tool for drug discovery and development.
Check Digit Verification of cas no
The CAS Registry Mumber 81701-13-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,7,0 and 1 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 81701-13:
(7*8)+(6*1)+(5*7)+(4*0)+(3*1)+(2*1)+(1*3)=105
105 % 10 = 5
So 81701-13-5 is a valid CAS Registry Number.
InChI:InChI=1/C22H31FO2/c1-2-3-16-4-6-18(7-5-16)22(19-8-10-20(23)11-9-19)14-12-17(13-15-22)21(24)25/h8-11,16-18H,2-7,12-15H2,1H3,(H,24,25)/p-1