81735-49-1 Usage
General Description
1-((4,4-Dimethyl-4H-1,3-benzothiazin-2-yl)methyl)-2-pyrrolidinone hydrochloride is a chemical compound that is often used as a pharmaceutical intermediate. It is a hydrate of the hydrochloride salt form of the compound, which means it is in a crystalline form that contains water molecules. This chemical has potential applications in the development of medications due to its structural and functional properties. Its synthesis and purification processes are crucial for ensuring its quality and effectiveness in pharmaceutical production. Additionally, it is important to handle this compound with care and follow proper safety protocols due to its potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 81735-49-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,7,3 and 5 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 81735-49:
(7*8)+(6*1)+(5*7)+(4*3)+(3*5)+(2*4)+(1*9)=141
141 % 10 = 1
So 81735-49-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2OS.ClH/c1-15(2)11-6-3-4-7-12(11)19-13(16-15)10-17-9-5-8-14(17)18;/h3-4,6-7H,5,8-10H2,1-2H3;1H
