81735-49-1 Usage
Uses
Used in Pharmaceutical Industry:
1-((4,4-Dimethyl-4H-1,3-benzothiazin-2-yl)methyl)-2-pyrrolidinone hydrochloride is used as a pharmaceutical intermediate for the development of various medications. Its structural and functional properties contribute to the creation of effective drug compounds, enhancing their therapeutic potential and overall efficacy.
Used in Medication Development:
1-((4,4-Dimethyl-4H-1,3-benzothiazin-2-yl)methyl)-2-pyrrolidinone hydrochloride is utilized in the development of new medications, particularly those targeting specific health conditions. Its unique properties allow for the creation of innovative drug formulations with improved pharmacological profiles.
Used in Quality Assurance:
The synthesis and purification processes of 1-((4,4-Dimethyl-4H-1,3-benzothiazin-2-yl)methyl)-2-pyrrolidinone hydrochloride are crucial for ensuring its quality and effectiveness in pharmaceutical production. 1-((4,4-Dimethyl-4H-1,3-benzothiazin-2-yl)methyl)-2-pyrrolidinone hydr ochloride plays a vital role in maintaining high standards within the pharmaceutical industry, contributing to the overall safety and efficacy of medications.
Check Digit Verification of cas no
The CAS Registry Mumber 81735-49-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,7,3 and 5 respectively; the second part has 2 digits, 4 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 81735-49:
(7*8)+(6*1)+(5*7)+(4*3)+(3*5)+(2*4)+(1*9)=141
141 % 10 = 1
So 81735-49-1 is a valid CAS Registry Number.
InChI:InChI=1/C15H18N2OS.ClH/c1-15(2)11-6-3-4-7-12(11)19-13(16-15)10-17-9-5-8-14(17)18;/h3-4,6-7H,5,8-10H2,1-2H3;1H
