81744-15-2 Usage
Chemical structure
A synthetic organic compound containing a benzisoselenazol ring with a bromo and hydroxy functional group attached to it.
Potential applications
Medicinal chemistry due to its structural features and potential pharmacological properties.
Chemical reactivity
The bromo and hydroxy groups present in the compound make it suitable for various chemical reactions and modifications.
Value as a building block
It can be used for the synthesis of new drugs or bioactive molecules due to its reactivity and structural features.
Biological activity
The presence of the benzisoselenazol ring in the structure may contribute to its biological activity and potential for further pharmaceutical development.
Structural features
The compound has a unique structure that can be exploited for the development of new drugs or bioactive molecules.
Synthesis
The compound can be synthesized through various chemical reactions and modifications, making it a valuable building block for the development of new drugs.
Pharmacological properties
The compound has potential pharmacological properties due to its unique structure and functional groups.
Research potential
Further research is needed to fully understand the compound's pharmacological properties and potential applications in medicinal chemistry.
Safety and handling
As with any chemical compound, appropriate safety measures should be taken when handling and working with 1,2-Benzisoselenazol-3(2H)-one, 2-(3-bromo-4-hydroxyphenyl)-.
Check Digit Verification of cas no
The CAS Registry Mumber 81744-15-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,7,4 and 4 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 81744-15:
(7*8)+(6*1)+(5*7)+(4*4)+(3*4)+(2*1)+(1*5)=132
132 % 10 = 2
So 81744-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C13H8BrNO2Se/c14-10-7-8(5-6-11(10)16)15-13(17)9-3-1-2-4-12(9)18-15/h1-7,16H
