81793-56-8 Usage
Uses
Used in Pharmaceutical Synthesis:
1,1'-Biphenyl, 4-fluoro-4'-(4-methylcyclohexyl)-, transis utilized as a key intermediate in the synthesis of various pharmaceuticals and organic compounds. Its unique structure and properties make it a valuable component in the development of new drugs and organic materials.
Used in Organic Compounds Synthesis:
In the field of organic chemistry, 1,1'-Biphenyl, 4-fluoro-4'-(4-methylcyclohexyl)-, transserves as a building block for the creation of complex organic molecules. Its versatility in chemical reactions allows for the synthesis of a wide range of organic compounds with diverse applications.
Used in Chemical Research:
1,1'-Biphenyl, 4-fluoro-4'-(4-methylcyclohexyl)-, transis also employed in chemical research for studying the properties and behavior of trans isomers and their potential applications in various fields. Its unique structure provides insights into the effects of molecular geometry on chemical reactivity and stability.
Check Digit Verification of cas no
The CAS Registry Mumber 81793-56-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,7,9 and 3 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 81793-56:
(7*8)+(6*1)+(5*7)+(4*9)+(3*3)+(2*5)+(1*6)=158
158 % 10 = 8
So 81793-56-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H21F/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)18-10-12-19(20)13-11-18/h6-15H,2-5H2,1H3/t14-,15-
