81870-64-6 Usage
Uses
Used in Organic Synthesis:
((Chloromethyl)phenylethyl)methyldichlorosilane is utilized as a reagent in organic synthesis, contributing to the formation of various complex organic molecules. Its unique structure allows it to participate in a range of chemical reactions, making it a valuable component in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Production of Organosilicon Compounds:
As a precursor, ((Chloromethyl)phenylethyl)methyldichlorosilane is instrumental in the production of other organosilicon compounds. These compounds are known for their thermal stability, hydrophobicity, and unique physical and chemical properties, which find applications in various industries.
Used in Polymer Industry:
((Chloromethyl)phenylethyl)methyldichlorosilane is employed as a component in the manufacturing of polymers. Its incorporation into polymer structures can enhance properties such as flexibility, durability, and resistance to environmental factors, making the resulting polymers suitable for a wide range of applications, including automotive, aerospace, and electronics.
Used in Adhesives and Coatings Industry:
In the adhesives and coatings sector, ((Chloromethyl)phenylethyl)methyldichlorosilane is used to improve the performance of these products. Its presence can enhance adhesion strength, chemical resistance, and durability of the final product, making it suitable for use in construction, automotive, and industrial applications where high-performance adhesives and coatings are required.
Check Digit Verification of cas no
The CAS Registry Mumber 81870-64-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,8,7 and 0 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 81870-64:
(7*8)+(6*1)+(5*8)+(4*7)+(3*0)+(2*6)+(1*4)=146
146 % 10 = 6
So 81870-64-6 is a valid CAS Registry Number.
InChI:InChI=1/C10H12Cl3Si/c11-8-10-5-2-1-4-9(10)6-3-7-14(12)13/h1-2,4-5H,3,6-8H2
