81890-59-7 Usage
General Description
(E)-9-Fluoro-11-(3-dimethylaminopropylidene)-6,11-dihydrodibenzo(b,e)thiepin hydrogen maleate is a chemical compound with potential pharmaceutical applications. It is a derivative of dibenzothiepin, a tricyclic molecule with a central seven-membered thiepine ring. The addition of a fluorine atom at the 9th position and a dimethylaminopropylidene group at the 11th position contributes to its pharmacological properties. (E)-9-Fluoro-11-(3-dimethylaminopropylidene)-6,11-dihydrodibenzo(b,e)t hiepin hydrogen maleate is typically found as a hydrogen maleate salt, which can enhance its solubility and stability for medicinal use. It is of interest in the development of new psychiatric drugs due to its potential as a psychoactive agent, particularly in the treatment of mood disorders such as depression and anxiety. Further research is needed to fully understand its pharmacological effects and potential therapeutic uses.
Check Digit Verification of cas no
The CAS Registry Mumber 81890-59-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,8,9 and 0 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 81890-59:
(7*8)+(6*1)+(5*8)+(4*9)+(3*0)+(2*5)+(1*9)=157
157 % 10 = 7
So 81890-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C19H20FNS.C4H4O4/c1-21(2)11-5-7-16-17-6-3-4-8-19(17)22-13-14-9-10-15(20)12-18(14)16;5-3(6)1-2-4(7)8/h3-4,6-10,12H,5,11,13H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b16-7-;2-1+
