81945-10-0 Usage
Uses
Used in Research Applications:
4-Chloro-2,3-dihydro-7-hydroxyinden-1-one is used as a research chemical for the investigation of its properties and potential applications in various scientific fields. It is particularly valuable in synthetic chemistry, where it serves as a precursor for the production of other complex molecules.
Used in Synthetic Chemistry:
In the field of synthetic chemistry, 4-Chloro-2,3-dihydro-7-hydroxyinden-1-one is used as a key intermediate compound in the synthesis of more complex organic molecules. Its unique structure and reactivity make it a valuable component in the creation of new chemical entities with potential applications in various industries.
Storage and Safety:
4-Chloro-2,3-dihydro-7-hydroxyinden-1-one should be stored in a cool, dry place to maintain its stability. It is crucial to keep it away from strong oxidizing agents to prevent any potential hazards. Due to the limited information on its health effects, it is recommended to handle 4-Chloro-2,3-dihydro-7-hydroxyinden-1-one with appropriate safety precautions, such as wearing protective gear and working in a well-ventilated area.
Check Digit Verification of cas no
The CAS Registry Mumber 81945-10-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,9,4 and 5 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 81945-10:
(7*8)+(6*1)+(5*9)+(4*4)+(3*5)+(2*1)+(1*0)=140
140 % 10 = 0
So 81945-10-0 is a valid CAS Registry Number.
InChI:InChI=1/C9H7ClO2/c10-6-2-4-8(12)9-5(6)1-3-7(9)11/h2,4,12H,1,3H2
