81963-87-3 Usage
Chemical structure
The compound contains an oxadiazole-2(3H)-thione ring, a 3,5-dibromo-2-hydroxyphenyl group, and a 1-piperidinylmethyl side chain.
Molecular weight
The molecular weight of the compound is approximately 376.11 g/mol.
Functional groups
The compound features an oxadiazole-2(3H)-thione ring, a 3,5-dibromo-2-hydroxyphenyl group, and a 1-piperidinylmethyl side chain.
Potential applications
The compound may have potential applications in the field of medicinal chemistry due to its diverse biological activities, including antimicrobial, antiviral, and anticancer properties.
Pharmacological activity
The presence of the piperidinylmethyl group may indicate potential pharmacological activity, as piperidine-based compounds are commonly found in drugs and bioactive molecules.
Further research
Further research and investigation are needed to fully understand the properties and potential uses of this chemical compound.
Biological activities
Oxadiazole derivatives are known for their diverse biological activities, which may include antimicrobial, antiviral, and anticancer properties.
Structural features
The compound has a complex structure with multiple functional groups and a heterocyclic ring system.
Synthesis
The synthesis of this compound may involve the formation of the oxadiazole-2(3H)-thione ring, followed by the introduction of the 3,5-dibromo-2-hydroxyphenyl group and the 1-piperidinylmethyl side chain.
Check Digit Verification of cas no
The CAS Registry Mumber 81963-87-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,1,9,6 and 3 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 81963-87:
(7*8)+(6*1)+(5*9)+(4*6)+(3*3)+(2*8)+(1*7)=163
163 % 10 = 3
So 81963-87-3 is a valid CAS Registry Number.
InChI:InChI=1/C14H15Br2N3O2S/c15-9-6-10(12(20)11(16)7-9)13-17-19(14(22)21-13)8-18-4-2-1-3-5-18/h6-7,17H,1-5,8H2/b13-10+
