819850-15-2 Usage
General Description
2-Methyl-3-pyrimidin-4-yl-propionic acid, also known as MPPA, is a chemical compound with the molecular formula C8H9N2O2. It is a derivative of pyrimidine and propionic acid and is used in the synthesis of various pharmaceuticals and agrochemicals. MPPA has potential applications in the development of anti-inflammatory drugs and is being researched for its potential therapeutic properties. It is also used as a precursor in organic synthesis for the production of various compounds. Additionally, MPPA may have use in the development of novel materials and in the production of various industrial products.
Check Digit Verification of cas no
The CAS Registry Mumber 819850-15-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,1,9,8,5 and 0 respectively; the second part has 2 digits, 1 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 819850-15:
(8*8)+(7*1)+(6*9)+(5*8)+(4*5)+(3*0)+(2*1)+(1*5)=192
192 % 10 = 2
So 819850-15-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O2/c1-6(8(11)12)5-7-9-3-2-4-10-7/h2-4,6H,5H2,1H3,(H,11,12)
