82010-84-2 Usage
Classification
Diol It is classified as a diol due to the presence of two hydroxyl (OH) functional groups in its structure.
Functional groups
Two hydroxyl (OH) groups, two thioether (S) groups The presence of these functional groups allows the compound to participate in various chemical reactions and contributes to its versatility in industrial applications.
Usage as a building block
Synthesis of various organic compounds 2,2'-[(2-methylbutane-1,4-diyl)bis(thio)]bisethanol is commonly used as a starting material in the synthesis of different organic compounds.
Usage as a coupling agent
Production of coatings, adhesives, and sealants It serves as a coupling agent in the manufacturing process of various industrial products, such as coatings, adhesives, and sealants.
Applications in manufacturing
Antioxidants, plasticizers, and surfactants The compound is also used in the production of antioxidants, plasticizers, and surfactants due to its chemical properties and functional groups.
Chemical structure
2-methylbutane-1,4-diyl backbone with two thioether (S) groups and two hydroxyl groups The compound's structure features a 2-methylbutane-1,4-diyl backbone, with two thioether groups and two hydroxyl groups attached to it, contributing to its reactivity and usefulness in various industrial processes.
Check Digit Verification of cas no
The CAS Registry Mumber 82010-84-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,0,1 and 0 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 82010-84:
(7*8)+(6*2)+(5*0)+(4*1)+(3*0)+(2*8)+(1*4)=92
92 % 10 = 2
So 82010-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H20O2S2/c1-9(8-13-7-4-11)2-5-12-6-3-10/h9-11H,2-8H2,1H3
