820245-84-9 Usage
Uses
Used in Organic Synthesis:
2,7-DIMETHYL-IMIDAZO[1,2-A]PYRIDINE-3-CARBALDEHYDE is used as a building block for the synthesis of various organic compounds. Its unique structure allows for the creation of a wide range of chemical entities, making it a valuable component in the field of organic chemistry.
Used in Medicinal Chemistry:
In the pharmaceutical industry, 2,7-DIMETHYL-IMIDAZO[1,2-A]PYRIDINE-3-CARBALDEHYDE is utilized as a key intermediate in the development of new pharmaceuticals. Its presence in the molecular structure of potential drug candidates can contribute to their therapeutic properties, such as improved efficacy or reduced side effects.
Used in Pharmaceutical Synthesis:
2,7-DIMETHYL-IMIDAZO[1,2-A]PYRIDINE-3-CARBALDEHYDE is used as a starting material in the synthesis of various pharmaceuticals. Its reactivity and structural features make it a suitable candidate for the development of new drugs, potentially leading to innovative treatments for a range of medical conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 820245-84-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 8,2,0,2,4 and 5 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 820245-84:
(8*8)+(7*2)+(6*0)+(5*2)+(4*4)+(3*5)+(2*8)+(1*4)=139
139 % 10 = 9
So 820245-84-9 is a valid CAS Registry Number.
InChI:InChI=1/C10H10N2O/c1-7-3-4-12-9(6-13)8(2)11-10(12)5-7/h3-6H,1-2H3
820245-84-9Relevant academic research and scientific papers
Aerobic iron(III)-catalyzed direct formylation of imidazo[1,2-a]pyridine using DMSO as carbon source
Xiang, Shijian,Chen, Huoji,Liu, Qiang
supporting information, p. 3870 - 3872 (2016/08/02)
A novel and efficient iron(III)-catalyzed C3-formylation reaction of imidazo[1,2-a]pyridine in an oxygen atmosphere has been developed. The method is conducted in dimethyl sulfoxide (DMSO), which serves as both the carbonyl carbon source and solvent, in the presence of acetic acid to directly generate structurally diverse 3-formylimidazo[1,2-a]pyridine derivatives in moderate to good yields.
Cu-Catalyzed selective C3-formylation of imidazo[1,2-a]pyridine C-H bonds with DMSO using molecular oxygen
Cao, Hua,Lei, Sai,Li, Naiying,Chen, Longbin,Liu, Jingyun,Cai, Huiyin,Qiu, Shuxian,Tan, Jingwen
supporting information, p. 1823 - 1825 (2015/01/30)
Using the widely available DMSO as the formylation reagent under oxidative conditions, an efficient Cu-catalyzed C3-formylation reaction of imidazo[1,2-a]pyridine C-H bonds to directly generate structurally sophisticated 3-formyl imidazo[1,2-a]pyridine derivatives has been developed. The reaction proceeded to generate products in good yields, and used the environmentally friendly molecular oxygen as the oxidant.
