82131-87-1 Usage
Description
8-[(2-Nitrobenzyl)oxy]quinoline is a quinoline-based organic compound with the chemical formula C20H13NO3 and a molecular weight of 315.32 g/mol. It features a nitrobenzyl group attached to the quinoline core, which imparts unique reactivity and makes it a valuable compound in the fields of organic and medicinal chemistry.
Uses
Used in Organic Synthesis:
8-[(2-Nitrobenzyl)oxy]quinoline is used as a building block in organic synthesis for the preparation of various chemical compounds. Its unique reactivity, due to the presence of the nitrobenzyl group, allows for the formation of diverse organic molecules with potential applications in various industries.
Used in Pharmaceutical Industry:
8-[(2-Nitrobenzyl)oxy]quinoline is used as a key intermediate in the development of new drugs. Its potential use in the pharmaceutical industry has been studied, and it has shown promise in certain medical applications. 8-[(2-Nitrobenzyl)oxy]quinoline's unique structure and reactivity make it a valuable candidate for the synthesis of novel pharmaceutical agents.
Used in Drug Development:
8-[(2-Nitrobenzyl)oxy]quinoline is employed as a starting material in the development of new drugs. Its unique chemical properties and reactivity make it a promising candidate for the creation of innovative therapeutic agents with potential applications in various medical fields. 8-[(2-Nitrobenzyl)oxy]quinoline's versatility in organic synthesis and its potential in pharmaceutical applications make it an important compound in drug discovery and development processes.
Check Digit Verification of cas no
The CAS Registry Mumber 82131-87-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 8,2,1,3 and 1 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 82131-87:
(7*8)+(6*2)+(5*1)+(4*3)+(3*1)+(2*8)+(1*7)=111
111 % 10 = 1
So 82131-87-1 is a valid CAS Registry Number.
InChI:InChI=1/C16H12N2O3/c19-18(20)14-8-2-1-5-13(14)11-21-15-9-3-6-12-7-4-10-17-16(12)15/h1-10H,11H2
82131-87-1Relevant articles and documents
Photocleavable metal-chelating agents and compositions containing the same
-
, (2008/06/13)
Chelating agents for a transition metal, which exhibit the special feature of being photocleavable, that is containing a chelating functional group blocked by a photocleavable protecting group such that the chelating functional group is released only on e